C21H22ClFN4O4S — CID 87384314
[5-(2-chloro-3-pyridinyl)-4-fluoro-1-pyridin-3-ylsulfonylpyrrol-3-yl]methyl-(2,2-dimethylpropyl)carbamic acid (PubChem CID 87384314) has the molecular formula C21H22ClFN4O4S and a molecular weight of 480.95 g/mol. Its IUPAC name is [5-(2-chloro-3-pyridinyl)-4-fluoro-1-pyridin-3-ylsulfonylpyrrol-3-yl]methyl-(2,2-dimethylpropyl)carbamic acid.
| Compound Name | [5-(2-chloro-3-pyridinyl)-4-fluoro-1-pyridin-3-ylsulfonylpyrrol-3-yl]methyl-(2,2-dimethylpropyl)carbamic acid |
|---|---|
| PubChem CID | 87384314 |
| Molecular Formula | C21H22ClFN4O4S |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | [5-(2-chloro-3-pyridinyl)-4-fluoro-1-pyridin-3-ylsulfonylpyrrol-3-yl]methyl-(2,2-dimethylpropyl)carbamic acid |
| SMILES | CC(C)(C)CN(Cc1cn(S(=O)(=O)c2cccnc2)c(-c2cccnc2Cl)c1F)C(=O)O |
| InChI | InChI=1S/C21H22ClFN4O4S/c1-21(2,3)13-26(20(28)29)11-14-12-27(32(30,31)15-6-4-8-24-10-15)18(17(14)23)16-7-5-9-25-19(16)22/h4-10,12H,11,13H2,1-3H3,(H,28,29) |
| InChIKey | FOASKLQFDMBOTJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|