C20H26F2N4O5S — CID 67396951
2,2-dimethylpropyl-[[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-morpholin-4-ylsulfonylpyrrol-3-yl]methyl]carbamic acid (PubChem CID 67396951) has the molecular formula C20H26F2N4O5S and a molecular weight of 472.51 g/mol. Its IUPAC name is 2,2-dimethylpropyl-[[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-morpholin-4-ylsulfonylpyrrol-3-yl]methyl]carbamic acid.
| Compound Name | 2,2-dimethylpropyl-[[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-morpholin-4-ylsulfonylpyrrol-3-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 67396951 |
| Molecular Formula | C20H26F2N4O5S |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2,2-dimethylpropyl-[[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-morpholin-4-ylsulfonylpyrrol-3-yl]methyl]carbamic acid |
| SMILES | CC(C)(C)CN(Cc1cn(S(=O)(=O)N2CCOCC2)c(-c2cccnc2F)c1F)C(=O)O |
| InChI | InChI=1S/C20H26F2N4O5S/c1-20(2,3)13-24(19(27)28)11-14-12-26(32(29,30)25-7-9-31-10-8-25)17(16(14)21)15-5-4-6-23-18(15)22/h4-6,12H,7-11,13H2,1-3H3,(H,27,28) |
| InChIKey | YBDBUXOGWPFWEY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|