C20H21F2N3O4S2 — CID 67399485
2,2-dimethylpropyl-[[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-thiophen-3-ylsulfonylpyrrol-3-yl]methyl]carbamic acid (PubChem CID 67399485) has the molecular formula C20H21F2N3O4S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2,2-dimethylpropyl-[[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-thiophen-3-ylsulfonylpyrrol-3-yl]methyl]carbamic acid.
| Compound Name | 2,2-dimethylpropyl-[[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-thiophen-3-ylsulfonylpyrrol-3-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 67399485 |
| Molecular Formula | C20H21F2N3O4S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2,2-dimethylpropyl-[[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-thiophen-3-ylsulfonylpyrrol-3-yl]methyl]carbamic acid |
| SMILES | CC(C)(C)CN(Cc1cn(S(=O)(=O)c2ccsc2)c(-c2cccnc2F)c1F)C(=O)O |
| InChI | InChI=1S/C20H21F2N3O4S2/c1-20(2,3)12-24(19(26)27)9-13-10-25(31(28,29)14-6-8-30-11-14)17(16(13)21)15-5-4-7-23-18(15)22/h4-8,10-11H,9,12H2,1-3H3,(H,26,27) |
| InChIKey | QJGSBIJWBGEKMJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|