C17H15F2N3O5S — CID 67399042
[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-(2-methylfuran-3-yl)sulfonylpyrrol-3-yl]methyl-methylcarbamic acid (PubChem CID 67399042) has the molecular formula C17H15F2N3O5S and a molecular weight of 411.39 g/mol. Its IUPAC name is [4-fluoro-5-(2-fluoro-3-pyridinyl)-1-(2-methylfuran-3-yl)sulfonylpyrrol-3-yl]methyl-methylcarbamic acid.
| Compound Name | [4-fluoro-5-(2-fluoro-3-pyridinyl)-1-(2-methylfuran-3-yl)sulfonylpyrrol-3-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 67399042 |
| Molecular Formula | C17H15F2N3O5S |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [4-fluoro-5-(2-fluoro-3-pyridinyl)-1-(2-methylfuran-3-yl)sulfonylpyrrol-3-yl]methyl-methylcarbamic acid |
| SMILES | Cc1occc1S(=O)(=O)n1cc(CN(C)C(=O)O)c(F)c1-c1cccnc1F |
| InChI | InChI=1S/C17H15F2N3O5S/c1-10-13(5-7-27-10)28(25,26)22-9-11(8-21(2)17(23)24)14(18)15(22)12-4-3-6-20-16(12)19/h3-7,9H,8H2,1-2H3,(H,23,24) |
| InChIKey | HUZRKKAZMYAFQS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|