C21H20F2N4O6S — CID 67177729
but-2-enedioic acid;1-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[(3-methyl-2-pyridinyl)sulfonyl]pyrrol-3-yl]-N-methylmethanamine (PubChem CID 67177729) has the molecular formula C21H20F2N4O6S and a molecular weight of 494.48 g/mol. Its IUPAC name is but-2-enedioic acid;1-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[(3-methyl-2-pyridinyl)sulfonyl]pyrrol-3-yl]-N-methylmethanamine.
| Compound Name | but-2-enedioic acid;1-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[(3-methyl-2-pyridinyl)sulfonyl]pyrrol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 67177729 |
| Molecular Formula | C21H20F2N4O6S |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | but-2-enedioic acid;1-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[(3-methyl-2-pyridinyl)sulfonyl]pyrrol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cn(S(=O)(=O)c2ncccc2C)c(-c2cccnc2F)c1F.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H16F2N4O2S.C4H4O4/c1-11-5-3-8-22-17(11)26(24,25)23-10-12(9-20-2)14(18)15(23)13-6-4-7-21-16(13)19;5-3(6)1-2-4(7)8/h3-8,10,20H,9H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | IVYHZEHWVCCELM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|