C17H13F3N4O4S — CID 67313273
2-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[(5-fluoro-3-pyridinyl)sulfonyl]pyrrol-3-yl]ethylcarbamic acid (PubChem CID 67313273) has the molecular formula C17H13F3N4O4S and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[(5-fluoro-3-pyridinyl)sulfonyl]pyrrol-3-yl]ethylcarbamic acid.
| Compound Name | 2-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[(5-fluoro-3-pyridinyl)sulfonyl]pyrrol-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 67313273 |
| Molecular Formula | C17H13F3N4O4S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[(5-fluoro-3-pyridinyl)sulfonyl]pyrrol-3-yl]ethylcarbamic acid |
| SMILES | O=C(O)NCCc1cn(S(=O)(=O)c2cncc(F)c2)c(-c2cccnc2F)c1F |
| InChI | InChI=1S/C17H13F3N4O4S/c18-11-6-12(8-21-7-11)29(27,28)24-9-10(3-5-23-17(25)26)14(19)15(24)13-2-1-4-22-16(13)20/h1-2,4,6-9,23H,3,5H2,(H,25,26) |
| InChIKey | JINAUDOKRQFGDM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|