C20H19F2N3O4S2 — CID 69275714
2-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[3-(methylsulfanylmethyl)phenyl]sulfonylpyrrol-3-yl]ethylcarbamic acid (PubChem CID 69275714) has the molecular formula C20H19F2N3O4S2 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[3-(methylsulfanylmethyl)phenyl]sulfonylpyrrol-3-yl]ethylcarbamic acid.
| Compound Name | 2-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[3-(methylsulfanylmethyl)phenyl]sulfonylpyrrol-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 69275714 |
| Molecular Formula | C20H19F2N3O4S2 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 2-[4-fluoro-5-(2-fluoro-3-pyridinyl)-1-[3-(methylsulfanylmethyl)phenyl]sulfonylpyrrol-3-yl]ethylcarbamic acid |
| SMILES | CSCc1cccc(S(=O)(=O)n2cc(CCNC(=O)O)c(F)c2-c2cccnc2F)c1 |
| InChI | InChI=1S/C20H19F2N3O4S2/c1-30-12-13-4-2-5-15(10-13)31(28,29)25-11-14(7-9-24-20(26)27)17(21)18(25)16-6-3-8-23-19(16)22/h2-6,8,10-11,24H,7,9,12H2,1H3,(H,26,27) |
| InChIKey | MCUGZHVSTRVHQP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|