C23H22F2N4O4S — CID 67396708
[1-[1-(3-cyanophenyl)sulfonyl-4-fluoro-5-(2-fluoro-3-pyridinyl)pyrrol-3-yl]-3,3-dimethylbutan-2-yl]carbamic acid (PubChem CID 67396708) has the molecular formula C23H22F2N4O4S and a molecular weight of 488.52 g/mol. Its IUPAC name is [1-[1-(3-cyanophenyl)sulfonyl-4-fluoro-5-(2-fluoro-3-pyridinyl)pyrrol-3-yl]-3,3-dimethylbutan-2-yl]carbamic acid.
| Compound Name | [1-[1-(3-cyanophenyl)sulfonyl-4-fluoro-5-(2-fluoro-3-pyridinyl)pyrrol-3-yl]-3,3-dimethylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67396708 |
| Molecular Formula | C23H22F2N4O4S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | [1-[1-(3-cyanophenyl)sulfonyl-4-fluoro-5-(2-fluoro-3-pyridinyl)pyrrol-3-yl]-3,3-dimethylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(C)C(Cc1cn(S(=O)(=O)c2cccc(C#N)c2)c(-c2cccnc2F)c1F)NC(=O)O |
| InChI | InChI=1S/C23H22F2N4O4S/c1-23(2,3)18(28-22(30)31)11-15-13-29(20(19(15)24)17-8-5-9-27-21(17)25)34(32,33)16-7-4-6-14(10-16)12-26/h4-10,13,18,28H,11H2,1-3H3,(H,30,31) |
| InChIKey | GSXLPALPQCKUJD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|