C19H14FN3O4S2 — CID 140538105
[5-(3-cyanophenyl)sulfonyl-4-(2-fluoro-3-pyridinyl)thiophen-2-yl]methyl N-methylcarbamate (PubChem CID 140538105) has the molecular formula C19H14FN3O4S2 and a molecular weight of 431.47 g/mol. Its IUPAC name is [5-(3-cyanophenyl)sulfonyl-4-(2-fluoro-3-pyridinyl)thiophen-2-yl]methyl N-methylcarbamate.
| Compound Name | [5-(3-cyanophenyl)sulfonyl-4-(2-fluoro-3-pyridinyl)thiophen-2-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 140538105 |
| Molecular Formula | C19H14FN3O4S2 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | [5-(3-cyanophenyl)sulfonyl-4-(2-fluoro-3-pyridinyl)thiophen-2-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1cc(-c2cccnc2F)c(S(=O)(=O)c2cccc(C#N)c2)s1 |
| InChI | InChI=1S/C19H14FN3O4S2/c1-22-19(24)27-11-13-9-16(15-6-3-7-23-17(15)20)18(28-13)29(25,26)14-5-2-4-12(8-14)10-21/h2-9H,11H2,1H3,(H,22,24) |
| InChIKey | BFHBCMOUWCKHCY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|