C21H20FN3O7S2 — CID 68919622
but-2-enedioic acid;1-[4-(2-fluoro-3-pyridinyl)-5-[(6-methoxy-2-pyridinyl)sulfonyl]thiophen-2-yl]-N-methylmethanamine (PubChem CID 68919622) has the molecular formula C21H20FN3O7S2 and a molecular weight of 509.54 g/mol. Its IUPAC name is but-2-enedioic acid;1-[4-(2-fluoro-3-pyridinyl)-5-[(6-methoxy-2-pyridinyl)sulfonyl]thiophen-2-yl]-N-methylmethanamine.
| Compound Name | but-2-enedioic acid;1-[4-(2-fluoro-3-pyridinyl)-5-[(6-methoxy-2-pyridinyl)sulfonyl]thiophen-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 68919622 |
| Molecular Formula | C21H20FN3O7S2 |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | but-2-enedioic acid;1-[4-(2-fluoro-3-pyridinyl)-5-[(6-methoxy-2-pyridinyl)sulfonyl]thiophen-2-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(-c2cccnc2F)c(S(=O)(=O)c2cccc(OC)n2)s1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H16FN3O3S2.C4H4O4/c1-19-10-11-9-13(12-5-4-8-20-16(12)18)17(25-11)26(22,23)15-7-3-6-14(21-15)24-2;5-3(6)1-2-4(7)8/h3-9,19H,10H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | LZSHMNJHPRDPLM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 155.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|