C20H21FN2O4S3 — CID 68729933
tert-butyl N-[[4-(2-fluoro-3-pyridinyl)-5-thiophen-3-ylsulfonylthiophen-2-yl]methyl]-N-methylcarbamate (PubChem CID 68729933) has the molecular formula C20H21FN2O4S3 and a molecular weight of 468.60 g/mol. Its IUPAC name is tert-butyl N-[[4-(2-fluoro-3-pyridinyl)-5-thiophen-3-ylsulfonylthiophen-2-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[4-(2-fluoro-3-pyridinyl)-5-thiophen-3-ylsulfonylthiophen-2-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 68729933 |
| Molecular Formula | C20H21FN2O4S3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | tert-butyl N-[[4-(2-fluoro-3-pyridinyl)-5-thiophen-3-ylsulfonylthiophen-2-yl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cc(-c2cccnc2F)c(S(=O)(=O)c2ccsc2)s1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H21FN2O4S3/c1-20(2,3)27-19(24)23(4)11-13-10-16(15-6-5-8-22-17(15)21)18(29-13)30(25,26)14-7-9-28-12-14/h5-10,12H,11H2,1-4H3 |
| InChIKey | KRPQBVPJBHNDEW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|