C16H13FN2O2S3 — CID 68924743
[4-(2-fluoro-3-pyridinyl)-5-thiophen-3-ylsulfanylthiophen-2-yl]methyl-methylcarbamic acid (PubChem CID 68924743) has the molecular formula C16H13FN2O2S3 and a molecular weight of 380.49 g/mol. Its IUPAC name is [4-(2-fluoro-3-pyridinyl)-5-thiophen-3-ylsulfanylthiophen-2-yl]methyl-methylcarbamic acid.
| Compound Name | [4-(2-fluoro-3-pyridinyl)-5-thiophen-3-ylsulfanylthiophen-2-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 68924743 |
| Molecular Formula | C16H13FN2O2S3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | [4-(2-fluoro-3-pyridinyl)-5-thiophen-3-ylsulfanylthiophen-2-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1cc(-c2cccnc2F)c(Sc2ccsc2)s1)C(=O)O |
| InChI | InChI=1S/C16H13FN2O2S3/c1-19(16(20)21)8-11-7-13(12-3-2-5-18-14(12)17)15(24-11)23-10-4-6-22-9-10/h2-7,9H,8H2,1H3,(H,20,21) |
| InChIKey | IHOCYGJPOMDUED-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|