C19H15N3O4S2 — CID 68924551
[4-(2-cyanophenyl)-5-pyridin-3-ylsulfonylthiophen-2-yl]methyl-methylcarbamic acid (PubChem CID 68924551) has the molecular formula C19H15N3O4S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is [4-(2-cyanophenyl)-5-pyridin-3-ylsulfonylthiophen-2-yl]methyl-methylcarbamic acid.
| Compound Name | [4-(2-cyanophenyl)-5-pyridin-3-ylsulfonylthiophen-2-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 68924551 |
| Molecular Formula | C19H15N3O4S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [4-(2-cyanophenyl)-5-pyridin-3-ylsulfonylthiophen-2-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1cc(-c2ccccc2C#N)c(S(=O)(=O)c2cccnc2)s1)C(=O)O |
| InChI | InChI=1S/C19H15N3O4S2/c1-22(19(23)24)12-14-9-17(16-7-3-2-5-13(16)10-20)18(27-14)28(25,26)15-6-4-8-21-11-15/h2-9,11H,12H2,1H3,(H,23,24) |
| InChIKey | TVYGHGZEPSOFBL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |