C18H14F2N2O4S2 — CID 68728487
[5-(3-fluorophenyl)sulfonyl-4-(2-fluoro-3-pyridinyl)thiophen-2-yl]methyl-methylcarbamic acid (PubChem CID 68728487) has the molecular formula C18H14F2N2O4S2 and a molecular weight of 424.45 g/mol. Its IUPAC name is [5-(3-fluorophenyl)sulfonyl-4-(2-fluoro-3-pyridinyl)thiophen-2-yl]methyl-methylcarbamic acid.
| Compound Name | [5-(3-fluorophenyl)sulfonyl-4-(2-fluoro-3-pyridinyl)thiophen-2-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 68728487 |
| Molecular Formula | C18H14F2N2O4S2 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | [5-(3-fluorophenyl)sulfonyl-4-(2-fluoro-3-pyridinyl)thiophen-2-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1cc(-c2cccnc2F)c(S(=O)(=O)c2cccc(F)c2)s1)C(=O)O |
| InChI | InChI=1S/C18H14F2N2O4S2/c1-22(18(23)24)10-12-9-15(14-6-3-7-21-16(14)20)17(27-12)28(25,26)13-5-2-4-11(19)8-13/h2-9H,10H2,1H3,(H,23,24) |
| InChIKey | KUFNGIWJPUZLTJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|