C17H16N2O4S3 — CID 130344906
[5-(3-methylsulfonyl-5-pyridin-3-ylphenyl)sulfonylthiophen-2-yl]methanamine (PubChem CID 130344906) has the molecular formula C17H16N2O4S3 and a molecular weight of 408.53 g/mol. Its IUPAC name is [5-(3-methylsulfonyl-5-pyridin-3-ylphenyl)sulfonylthiophen-2-yl]methanamine.
| Compound Name | [5-(3-methylsulfonyl-5-pyridin-3-ylphenyl)sulfonylthiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 130344906 |
| Molecular Formula | C17H16N2O4S3 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [5-(3-methylsulfonyl-5-pyridin-3-ylphenyl)sulfonylthiophen-2-yl]methanamine |
| SMILES | CS(=O)(=O)c1cc(-c2cccnc2)cc(S(=O)(=O)c2ccc(CN)s2)c1 |
| InChI | InChI=1S/C17H16N2O4S3/c1-25(20,21)15-7-13(12-3-2-6-19-11-12)8-16(9-15)26(22,23)17-5-4-14(10-18)24-17/h2-9,11H,10,18H2,1H3 |
| InChIKey | VIHMOJVYFRPWEY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |