C14H18N2O6S4 — CID 130358396
N-[2-[4-[5-(aminomethyl)thiophen-2-yl]sulfonylphenyl]sulfonylethyl]methanesulfonamide (PubChem CID 130358396) has the molecular formula C14H18N2O6S4 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[2-[4-[5-(aminomethyl)thiophen-2-yl]sulfonylphenyl]sulfonylethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[5-(aminomethyl)thiophen-2-yl]sulfonylphenyl]sulfonylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 130358396 |
| Molecular Formula | C14H18N2O6S4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | N-[2-[4-[5-(aminomethyl)thiophen-2-yl]sulfonylphenyl]sulfonylethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCS(=O)(=O)c1ccc(S(=O)(=O)c2ccc(CN)s2)cc1 |
| InChI | InChI=1S/C14H18N2O6S4/c1-24(17,18)16-8-9-25(19,20)12-3-5-13(6-4-12)26(21,22)14-7-2-11(10-15)23-14/h2-7,16H,8-10,15H2,1H3 |
| InChIKey | HZMUOEJFTHADGQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |