C14H17NO4S3 — CID 158924198
[5-(4-propylsulfonylphenyl)sulfonylthiophen-2-yl]methanamine (PubChem CID 158924198) has the molecular formula C14H17NO4S3 and a molecular weight of 359.49 g/mol. Its IUPAC name is [5-(4-propylsulfonylphenyl)sulfonylthiophen-2-yl]methanamine.
| Compound Name | [5-(4-propylsulfonylphenyl)sulfonylthiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 158924198 |
| Molecular Formula | C14H17NO4S3 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | [5-(4-propylsulfonylphenyl)sulfonylthiophen-2-yl]methanamine |
| SMILES | CCCS(=O)(=O)c1ccc(S(=O)(=O)c2ccc(CN)s2)cc1 |
| InChI | InChI=1S/C14H17NO4S3/c1-2-9-21(16,17)12-4-6-13(7-5-12)22(18,19)14-8-3-11(10-15)20-14/h3-8H,2,9-10,15H2,1H3 |
| InChIKey | FMJYKUCBEDGPMD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |