C19H24N2O6S3 — CID 175181061
[5-[4-(3-pyrrolidin-1-ylpropylsulfonyl)phenyl]sulfonylthiophen-2-yl]methyl carbamate (PubChem CID 175181061) has the molecular formula C19H24N2O6S3 and a molecular weight of 472.61 g/mol. Its IUPAC name is [5-[4-(3-pyrrolidin-1-ylpropylsulfonyl)phenyl]sulfonylthiophen-2-yl]methyl carbamate.
| Compound Name | [5-[4-(3-pyrrolidin-1-ylpropylsulfonyl)phenyl]sulfonylthiophen-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 175181061 |
| Molecular Formula | C19H24N2O6S3 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | [5-[4-(3-pyrrolidin-1-ylpropylsulfonyl)phenyl]sulfonylthiophen-2-yl]methyl carbamate |
| SMILES | NC(=O)OCc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)CCCN3CCCC3)cc2)s1 |
| InChI | InChI=1S/C19H24N2O6S3/c20-19(22)27-14-15-4-9-18(28-15)30(25,26)17-7-5-16(6-8-17)29(23,24)13-3-12-21-10-1-2-11-21/h4-9H,1-3,10-14H2,(H2,20,22) |
| InChIKey | XQUOMPGLCKONPC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |