C11H11NO2S2 — CID 130358016
[5-(benzenesulfonyl)thiophen-2-yl]methanamine (PubChem CID 130358016) has the molecular formula C11H11NO2S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is [5-(benzenesulfonyl)thiophen-2-yl]methanamine.
| Compound Name | [5-(benzenesulfonyl)thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 130358016 |
| Molecular Formula | C11H11NO2S2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | [5-(benzenesulfonyl)thiophen-2-yl]methanamine |
| SMILES | NCc1ccc(S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C11H11NO2S2/c12-8-9-6-7-11(15-9)16(13,14)10-4-2-1-3-5-10/h1-7H,8,12H2 |
| InChIKey | ORJXSVLLDNVYIZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |