About 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine
5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine (PubChem CID 175363529) has the molecular formula C22H25NO4S3
and a molecular weight of 463.65 g/mol. Its IUPAC name is 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine.
Molecular Properties
| Compound Name | 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine |
| PubChem CID | 175363529 |
| Molecular Formula | C22H25NO4S3 |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine |
| SMILES | CCc1cc(CC)cc(-c2cc(S(C)(=O)=O)cc(S(=O)(=O)c3ccc(NC)s3)c2)c1 |
| InChI | InChI=1S/C22H25NO4S3/c1-5-15-9-16(6-2)11-17(10-15)18-12-19(29(4,24)25)14-20(13-18)30(26,27)22-8-7-21(23-3)28-22/h7-14,23H,5-6H2,1-4H3 |
| InChIKey | UVEUJJUSUYCEIF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine?
The IUPAC name of 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine (CID 175363529) is 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine.
What is the SMILES notation for 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine?
The canonical SMILES for 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine is CCc1cc(CC)cc(-c2cc(S(C)(=O)=O)cc(S(=O)(=O)c3ccc(NC)s3)c2)c1.
What is the InChIKey of 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine?
The InChIKey is UVEUJJUSUYCEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO4S3/c1-5-15-9-16(6-2)11-17(10-15)18-12-19(29(4,24)25)14-20(13-18)30(26,27)22-8-7-21(23-3)28-22/h7-14,23H,5-6H2,1-4H3.
What are the key properties of 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine?
5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine has a molecular weight of 463.65 g/mol, XLogP of 4.82, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,5-diethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine is sourced from PubChem (CID 175363529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).