C20H21NO4S3 — CID 175363526
5-[3-(2-ethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine (PubChem CID 175363526) has the molecular formula C20H21NO4S3 and a molecular weight of 435.59 g/mol. Its IUPAC name is 5-[3-(2-ethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine.
| Compound Name | 5-[3-(2-ethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine |
|---|---|
| PubChem CID | 175363526 |
| Molecular Formula | C20H21NO4S3 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 5-[3-(2-ethylphenyl)-5-methylsulfonylphenyl]sulfonyl-N-methylthiophen-2-amine |
| SMILES | CCc1ccccc1-c1cc(S(C)(=O)=O)cc(S(=O)(=O)c2ccc(NC)s2)c1 |
| InChI | InChI=1S/C20H21NO4S3/c1-4-14-7-5-6-8-18(14)15-11-16(27(3,22)23)13-17(12-15)28(24,25)20-10-9-19(21-2)26-20/h5-13,21H,4H2,1-3H3 |
| InChIKey | GDFSFADNPQYLDB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |