C12H13NO2S2 — CID 159006983
[5-(3-methylsulfonylphenyl)thiophen-2-yl]methanamine (PubChem CID 159006983) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is [5-(3-methylsulfonylphenyl)thiophen-2-yl]methanamine.
| Compound Name | [5-(3-methylsulfonylphenyl)thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 159006983 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | [5-(3-methylsulfonylphenyl)thiophen-2-yl]methanamine |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(CN)s2)c1 |
| InChI | InChI=1S/C12H13NO2S2/c1-17(14,15)11-4-2-3-9(7-11)12-6-5-10(8-13)16-12/h2-7H,8,13H2,1H3 |
| InChIKey | WSNUBPNCFWNTDN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |