C15H11F3O4S2 — CID 59632486
(Z)-1,1,1-trifluoro-4-hydroxy-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]but-3-en-2-one (PubChem CID 59632486) has the molecular formula C15H11F3O4S2 and a molecular weight of 376.38 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-hydroxy-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]but-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-hydroxy-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 59632486 |
| Molecular Formula | C15H11F3O4S2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-hydroxy-4-[5-(3-methylsulfonylphenyl)thiophen-2-yl]but-3-en-2-one |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(/C(O)=C/C(=O)C(F)(F)F)s2)c1 |
| InChI | InChI=1S/C15H11F3O4S2/c1-24(21,22)10-4-2-3-9(7-10)12-5-6-13(23-12)11(19)8-14(20)15(16,17)18/h2-8,19H,1H3/b11-8- |
| InChIKey | RTNVFIQVDQFOQE-FLIBITNWSA-N |
| XLogP | 3.85 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|