C22H26F3N3O2S2 — CID 91423576
N-[2-[[4,4,4-trifluoro-3-imino-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butylidene]amino]ethyl]cyclopentanamine (PubChem CID 91423576) has the molecular formula C22H26F3N3O2S2 and a molecular weight of 485.60 g/mol. Its IUPAC name is N-[2-[[4,4,4-trifluoro-3-imino-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butylidene]amino]ethyl]cyclopentanamine.
| Compound Name | N-[2-[[4,4,4-trifluoro-3-imino-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butylidene]amino]ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 91423576 |
| Molecular Formula | C22H26F3N3O2S2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[2-[[4,4,4-trifluoro-3-imino-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butylidene]amino]ethyl]cyclopentanamine |
| SMILES | [H]/N=C(/C/C(=N\CCNC1CCCC1)c1ccc(-c2cccc(S(C)(=O)=O)c2)s1)C(F)(F)F |
| InChI | InChI=1S/C22H26F3N3O2S2/c1-32(29,30)17-8-4-5-15(13-17)19-9-10-20(31-19)18(14-21(26)22(23,24)25)28-12-11-27-16-6-2-3-7-16/h4-5,8-10,13,16,26-27H,2-3,6-7,11-12,14H2,1H3/b26-21-,28-18+ |
| InChIKey | BYCMGBIUIYJXSI-XHUVJEIGSA-N |
| XLogP | 5.11 |
| TPSA | 82.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|