C23H17F6N3O2S — CID 91013933
4,4,4-trifluoro-1-[4-(3-methylsulfonylphenyl)phenyl]-1-N-[3-(trifluoromethyl)-2-pyridinyl]butane-1,3-diimine (PubChem CID 91013933) has the molecular formula C23H17F6N3O2S and a molecular weight of 513.46 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-(3-methylsulfonylphenyl)phenyl]-1-N-[3-(trifluoromethyl)-2-pyridinyl]butane-1,3-diimine.
| Compound Name | 4,4,4-trifluoro-1-[4-(3-methylsulfonylphenyl)phenyl]-1-N-[3-(trifluoromethyl)-2-pyridinyl]butane-1,3-diimine |
|---|---|
| PubChem CID | 91013933 |
| Molecular Formula | C23H17F6N3O2S |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-(3-methylsulfonylphenyl)phenyl]-1-N-[3-(trifluoromethyl)-2-pyridinyl]butane-1,3-diimine |
| SMILES | [H]/N=C(/CC(=Nc1ncccc1C(F)(F)F)c1ccc(-c2cccc(S(C)(=O)=O)c2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H17F6N3O2S/c1-35(33,34)17-5-2-4-16(12-17)14-7-9-15(10-8-14)19(13-20(30)23(27,28)29)32-21-18(22(24,25)26)6-3-11-31-21/h2-12,30H,13H2,1H3/b30-20-,32-19? |
| InChIKey | JFTPNFKFUUYPEQ-TWDQXXLOSA-N |
| XLogP | 6.26 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|