C22H19F3N2O3S2 — CID 91103782
4,4,4-trifluoro-1-N-(2-methoxyphenyl)-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butane-1,3-diimine (PubChem CID 91103782) has the molecular formula C22H19F3N2O3S2 and a molecular weight of 480.53 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-N-(2-methoxyphenyl)-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butane-1,3-diimine.
| Compound Name | 4,4,4-trifluoro-1-N-(2-methoxyphenyl)-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butane-1,3-diimine |
|---|---|
| PubChem CID | 91103782 |
| Molecular Formula | C22H19F3N2O3S2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 4,4,4-trifluoro-1-N-(2-methoxyphenyl)-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]butane-1,3-diimine |
| SMILES | [H]/N=C(/C/C(=N\c1ccccc1OC)c1ccc(-c2cccc(S(C)(=O)=O)c2)s1)C(F)(F)F |
| InChI | InChI=1S/C22H19F3N2O3S2/c1-30-18-9-4-3-8-16(18)27-17(13-21(26)22(23,24)25)20-11-10-19(31-20)14-6-5-7-15(12-14)32(2,28)29/h3-12,26H,13H2,1-2H3/b26-21-,27-17+ |
| InChIKey | QHNIENMKRXUFLF-FVJNFCPOSA-N |
| XLogP | 5.92 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|