C25H24ClF3N2O2S2 — CID 90859879
1-N-(2-chlorophenyl)-1-[5-(3-ethylsulfonyl-5-propan-2-ylphenyl)thiophen-2-yl]-4,4,4-trifluorobutane-1,3-diimine (PubChem CID 90859879) has the molecular formula C25H24ClF3N2O2S2 and a molecular weight of 541.06 g/mol. Its IUPAC name is 1-N-(2-chlorophenyl)-1-[5-(3-ethylsulfonyl-5-propan-2-ylphenyl)thiophen-2-yl]-4,4,4-trifluorobutane-1,3-diimine.
| Compound Name | 1-N-(2-chlorophenyl)-1-[5-(3-ethylsulfonyl-5-propan-2-ylphenyl)thiophen-2-yl]-4,4,4-trifluorobutane-1,3-diimine |
|---|---|
| PubChem CID | 90859879 |
| Molecular Formula | C25H24ClF3N2O2S2 |
| Molecular Weight | 541.06 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 1-N-(2-chlorophenyl)-1-[5-(3-ethylsulfonyl-5-propan-2-ylphenyl)thiophen-2-yl]-4,4,4-trifluorobutane-1,3-diimine |
| SMILES | [H]/N=C(/C/C(=N\c1ccccc1Cl)c1ccc(-c2cc(C(C)C)cc(S(=O)(=O)CC)c2)s1)C(F)(F)F |
| InChI | InChI=1S/C25H24ClF3N2O2S2/c1-4-35(32,33)18-12-16(15(2)3)11-17(13-18)22-9-10-23(34-22)21(14-24(30)25(27,28)29)31-20-8-6-5-7-19(20)26/h5-13,15,30H,4,14H2,1-3H3/b30-24-,31-21+ |
| InChIKey | SLEMXUQIXNQKHW-JDZIFTSESA-N |
| XLogP | 8.08 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.06 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|