C20H18ClF3N2O2S — CID 91278625
2-methylsulfanylethyl 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]benzoate (PubChem CID 91278625) has the molecular formula C20H18ClF3N2O2S and a molecular weight of 442.89 g/mol. Its IUPAC name is 2-methylsulfanylethyl 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]benzoate.
| Compound Name | 2-methylsulfanylethyl 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]benzoate |
|---|---|
| PubChem CID | 91278625 |
| Molecular Formula | C20H18ClF3N2O2S |
| Molecular Weight | 442.89 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 2-methylsulfanylethyl 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]benzoate |
| SMILES | [H]/N=C(/C/C(=N\c1ccccc1Cl)c1ccc(C(=O)OCCSC)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H18ClF3N2O2S/c1-29-11-10-28-19(27)14-8-6-13(7-9-14)17(12-18(25)20(22,23)24)26-16-5-3-2-4-15(16)21/h2-9,25H,10-12H2,1H3/b25-18-,26-17+ |
| InChIKey | OZLROSRHKRJHQP-WLQRXMOLSA-N |
| XLogP | 5.95 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.89 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|