C22H20ClF3N2O2S — CID 68656079
2-propylsulfanylethyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate (PubChem CID 68656079) has the molecular formula C22H20ClF3N2O2S and a molecular weight of 468.93 g/mol. Its IUPAC name is 2-propylsulfanylethyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate.
| Compound Name | 2-propylsulfanylethyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 68656079 |
| Molecular Formula | C22H20ClF3N2O2S |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-propylsulfanylethyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate |
| SMILES | CCCSCCOC(=O)c1ccc(-c2cc(C(F)(F)F)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H20ClF3N2O2S/c1-2-12-31-13-11-30-21(29)16-9-7-15(8-10-16)19-14-20(22(24,25)26)27-28(19)18-6-4-3-5-17(18)23/h3-10,14H,2,11-13H2,1H3 |
| InChIKey | TUTNKNCEZGBTLG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|