C22H14ClF3N2O2S — CID 68655385
thiophen-2-ylmethyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate (PubChem CID 68655385) has the molecular formula C22H14ClF3N2O2S and a molecular weight of 462.88 g/mol. Its IUPAC name is thiophen-2-ylmethyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate.
| Compound Name | thiophen-2-ylmethyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 68655385 |
| Molecular Formula | C22H14ClF3N2O2S |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | thiophen-2-ylmethyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate |
| SMILES | O=C(OCc1cccs1)c1ccc(-c2cc(C(F)(F)F)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H14ClF3N2O2S/c23-17-5-1-2-6-18(17)28-19(12-20(27-28)22(24,25)26)14-7-9-15(10-8-14)21(29)30-13-16-4-3-11-31-16/h1-12H,13H2 |
| InChIKey | MNQBEQWUUVEXPZ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |