C22H21ClF3N3O2 — CID 59632671
3-(dimethylamino)propyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate (PubChem CID 59632671) has the molecular formula C22H21ClF3N3O2 and a molecular weight of 451.88 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate.
| Compound Name | 3-(dimethylamino)propyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate |
|---|---|
| PubChem CID | 59632671 |
| Molecular Formula | C22H21ClF3N3O2 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 3-(dimethylamino)propyl 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate |
| SMILES | CN(C)CCCOC(=O)c1ccc(-c2cc(C(F)(F)F)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H21ClF3N3O2/c1-28(2)12-5-13-31-21(30)16-10-8-15(9-11-16)19-14-20(22(24,25)26)27-29(19)18-7-4-3-6-17(18)23/h3-4,6-11,14H,5,12-13H2,1-2H3 |
| InChIKey | CTPDUCZQBUIZAG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|