C22H22ClF3N2O2S — CID 91329723
2-propylsulfanylethyl 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]benzoate (PubChem CID 91329723) has the molecular formula C22H22ClF3N2O2S and a molecular weight of 470.94 g/mol. Its IUPAC name is 2-propylsulfanylethyl 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]benzoate.
| Compound Name | 2-propylsulfanylethyl 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]benzoate |
|---|---|
| PubChem CID | 91329723 |
| Molecular Formula | C22H22ClF3N2O2S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-propylsulfanylethyl 4-[N-(2-chlorophenyl)-C-(3,3,3-trifluoro-2-iminopropyl)carbonimidoyl]benzoate |
| SMILES | [H]/N=C(/C/C(=N\c1ccccc1Cl)c1ccc(C(=O)OCCSCCC)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H22ClF3N2O2S/c1-2-12-31-13-11-30-21(29)16-9-7-15(8-10-16)19(14-20(27)22(24,25)26)28-18-6-4-3-5-17(18)23/h3-10,27H,2,11-14H2,1H3/b27-20-,28-19+ |
| InChIKey | GUJVJJBLXNARME-SJHBVPTOSA-N |
| XLogP | 6.73 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|