C22H16ClF3N2O3 — CID 59632872
furan-2-ylmethyl 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]benzoate (PubChem CID 59632872) has the molecular formula C22H16ClF3N2O3 and a molecular weight of 448.83 g/mol. Its IUPAC name is furan-2-ylmethyl 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]benzoate.
| Compound Name | furan-2-ylmethyl 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]benzoate |
|---|---|
| PubChem CID | 59632872 |
| Molecular Formula | C22H16ClF3N2O3 |
| Molecular Weight | 448.83 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | furan-2-ylmethyl 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]benzoate |
| SMILES | N/C(=C\C(=N/c1ccccc1Cl)c1ccc(C(=O)OCc2ccco2)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H16ClF3N2O3/c23-17-5-1-2-6-18(17)28-19(12-20(27)22(24,25)26)14-7-9-15(10-8-14)21(29)31-13-16-4-3-11-30-16/h1-12H,13,27H2/b20-12-,28-19+ |
| InChIKey | NFZKCQFQDJTEGF-AWNBKGDLSA-N |
| XLogP | 5.82 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.83 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|