C25H23ClF3N3O2 — CID 173499585
3-pyridin-3-ylpropyl 4-[C-(2-amino-3,3,3-trifluoroprop-1-enyl)-N-(2-chlorocyclohexa-1,5-dien-1-yl)carbonimidoyl]benzoate (PubChem CID 173499585) has the molecular formula C25H23ClF3N3O2 and a molecular weight of 489.93 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 4-[C-(2-amino-3,3,3-trifluoroprop-1-enyl)-N-(2-chlorocyclohexa-1,5-dien-1-yl)carbonimidoyl]benzoate.
| Compound Name | 3-pyridin-3-ylpropyl 4-[C-(2-amino-3,3,3-trifluoroprop-1-enyl)-N-(2-chlorocyclohexa-1,5-dien-1-yl)carbonimidoyl]benzoate |
|---|---|
| PubChem CID | 173499585 |
| Molecular Formula | C25H23ClF3N3O2 |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-pyridin-3-ylpropyl 4-[C-(2-amino-3,3,3-trifluoroprop-1-enyl)-N-(2-chlorocyclohexa-1,5-dien-1-yl)carbonimidoyl]benzoate |
| SMILES | NC(=C/C(=N\C1=C(Cl)CCC=C1)c1ccc(C(=O)OCCCc2cccnc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H23ClF3N3O2/c26-20-7-1-2-8-21(20)32-22(15-23(30)25(27,28)29)18-9-11-19(12-10-18)24(33)34-14-4-6-17-5-3-13-31-16-17/h2-3,5,8-13,15-16H,1,4,6-7,14,30H2/b23-15?,32-22+ |
| InChIKey | BOHAHDRHZLFULH-VJXAEYPNSA-N |
| XLogP | 5.87 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|