About 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate
2-pyridin-3-ylethyl 3-amino-4-bromobenzoate (PubChem CID 63263115) has the molecular formula C14H13BrN2O2
and a molecular weight of 321.17 g/mol. Its IUPAC name is 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate.
Molecular Properties
| Compound Name | 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate |
| PubChem CID | 63263115 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate |
| SMILES | Nc1cc(C(=O)OCCc2cccnc2)ccc1Br |
| InChI | InChI=1S/C14H13BrN2O2/c15-12-4-3-11(8-13(12)16)14(18)19-7-5-10-2-1-6-17-9-10/h1-4,6,8-9H,5,7,16H2 |
| InChIKey | XTUMBYOVQCBBRC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate?
The IUPAC name of 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate (CID 63263115) is 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate.
What is the SMILES notation for 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate?
The canonical SMILES for 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate is Nc1cc(C(=O)OCCc2cccnc2)ccc1Br.
What is the InChIKey of 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate?
The InChIKey is XTUMBYOVQCBBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2O2/c15-12-4-3-11(8-13(12)16)14(18)19-7-5-10-2-1-6-17-9-10/h1-4,6,8-9H,5,7,16H2.
What are the key properties of 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate?
2-pyridin-3-ylethyl 3-amino-4-bromobenzoate has a molecular weight of 321.17 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylethyl 3-amino-4-bromobenzoate is sourced from PubChem (CID 63263115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).