About 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate
2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate (PubChem CID 55169977) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate |
| PubChem CID | 55169977 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate |
| SMILES | Cc1ncc(N)cc1C(=O)OCCc1cccnc1 |
| InChI | InChI=1S/C14H15N3O2/c1-10-13(7-12(15)9-17-10)14(18)19-6-4-11-3-2-5-16-8-11/h2-3,5,7-9H,4,6,15H2,1H3 |
| InChIKey | HVHASOXSBMHLMW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate?
The IUPAC name of 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate (CID 55169977) is 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate.
What is the SMILES notation for 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate?
The canonical SMILES for 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate is Cc1ncc(N)cc1C(=O)OCCc1cccnc1.
What is the InChIKey of 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate?
The InChIKey is HVHASOXSBMHLMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-10-13(7-12(15)9-17-10)14(18)19-6-4-11-3-2-5-16-8-11/h2-3,5,7-9H,4,6,15H2,1H3.
What are the key properties of 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate?
2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate has a molecular weight of 257.29 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylethyl 5-amino-2-methylpyridine-3-carboxylate is sourced from PubChem (CID 55169977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).