About pyridine;2-pyridin-3-ylethyl acetate
pyridine;2-pyridin-3-ylethyl acetate (PubChem CID 23213945) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is pyridine;2-pyridin-3-ylethyl acetate.
Molecular Properties
| Compound Name | pyridine;2-pyridin-3-ylethyl acetate |
| PubChem CID | 23213945 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | pyridine;2-pyridin-3-ylethyl acetate |
| SMILES | CC(=O)OCCc1cccnc1.c1ccncc1 |
| InChI | InChI=1S/C9H11NO2.C5H5N/c1-8(11)12-6-4-9-3-2-5-10-7-9;1-2-4-6-5-3-1/h2-3,5,7H,4,6H2,1H3;1-5H |
| InChIKey | TWXUYAUOWGEHEA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridine;2-pyridin-3-ylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine;2-pyridin-3-ylethyl acetate?
The IUPAC name of pyridine;2-pyridin-3-ylethyl acetate (CID 23213945) is pyridine;2-pyridin-3-ylethyl acetate.
What is the SMILES notation for pyridine;2-pyridin-3-ylethyl acetate?
The canonical SMILES for pyridine;2-pyridin-3-ylethyl acetate is CC(=O)OCCc1cccnc1.c1ccncc1.
What is the InChIKey of pyridine;2-pyridin-3-ylethyl acetate?
The InChIKey is TWXUYAUOWGEHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C5H5N/c1-8(11)12-6-4-9-3-2-5-10-7-9;1-2-4-6-5-3-1/h2-3,5,7H,4,6H2,1H3;1-5H.
What are the key properties of pyridine;2-pyridin-3-ylethyl acetate?
pyridine;2-pyridin-3-ylethyl acetate has a molecular weight of 244.29 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine;2-pyridin-3-ylethyl acetate is sourced from PubChem (CID 23213945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).