C9H12N4O2 — CID 142116410
2-pyridin-3-ylethyl N-(diaminomethylidene)carbamate (PubChem CID 142116410) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-pyridin-3-ylethyl N-(diaminomethylidene)carbamate.
| Compound Name | 2-pyridin-3-ylethyl N-(diaminomethylidene)carbamate |
|---|---|
| PubChem CID | 142116410 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-pyridin-3-ylethyl N-(diaminomethylidene)carbamate |
| SMILES | NC(N)=NC(=O)OCCc1cccnc1 |
| InChI | InChI=1S/C9H12N4O2/c10-8(11)13-9(14)15-5-3-7-2-1-4-12-6-7/h1-2,4,6H,3,5H2,(H4,10,11,13,14) |
| InChIKey | MXUJCZPBNWIQKW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|