C13H18BrNO2 — CID 54957630
3,3-dimethylbutyl 3-amino-4-bromobenzoate (PubChem CID 54957630) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 3,3-dimethylbutyl 3-amino-4-bromobenzoate.
| Compound Name | 3,3-dimethylbutyl 3-amino-4-bromobenzoate |
|---|---|
| PubChem CID | 54957630 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3,3-dimethylbutyl 3-amino-4-bromobenzoate |
| SMILES | CC(C)(C)CCOC(=O)c1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C13H18BrNO2/c1-13(2,3)6-7-17-12(16)9-4-5-10(14)11(15)8-9/h4-5,8H,6-7,15H2,1-3H3 |
| InChIKey | IJGCWKAQTNPLKN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|