C14H19ClO4S — CID 66226010
3,3-dimethylbutyl 3-chlorosulfonyl-4-methylbenzoate (PubChem CID 66226010) has the molecular formula C14H19ClO4S and a molecular weight of 318.82 g/mol. Its IUPAC name is 3,3-dimethylbutyl 3-chlorosulfonyl-4-methylbenzoate.
| Compound Name | 3,3-dimethylbutyl 3-chlorosulfonyl-4-methylbenzoate |
|---|---|
| PubChem CID | 66226010 |
| Molecular Formula | C14H19ClO4S |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3,3-dimethylbutyl 3-chlorosulfonyl-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCC(C)(C)C)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C14H19ClO4S/c1-10-5-6-11(9-12(10)20(15,17)18)13(16)19-8-7-14(2,3)4/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | LLGFICDESLMRKA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |