C16H23NO4 — CID 138577922
4-O-(1-aminoethyl) 1-O-(3,3-dimethylbutyl) benzene-1,4-dicarboxylate (PubChem CID 138577922) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-O-(1-aminoethyl) 1-O-(3,3-dimethylbutyl) benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(1-aminoethyl) 1-O-(3,3-dimethylbutyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 138577922 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-O-(1-aminoethyl) 1-O-(3,3-dimethylbutyl) benzene-1,4-dicarboxylate |
| SMILES | CC(N)OC(=O)c1ccc(C(=O)OCCC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-11(17)21-15(19)13-7-5-12(6-8-13)14(18)20-10-9-16(2,3)4/h5-8,11H,9-10,17H2,1-4H3 |
| InChIKey | AUSDNHJDSJABCB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|