C28H44Cl2O4 — CID 71202814
bis(7-chloro-3,7-dimethyloctyl) benzene-1,4-dicarboxylate (PubChem CID 71202814) has the molecular formula C28H44Cl2O4 and a molecular weight of 515.56 g/mol. Its IUPAC name is bis(7-chloro-3,7-dimethyloctyl) benzene-1,4-dicarboxylate.
| Compound Name | bis(7-chloro-3,7-dimethyloctyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 71202814 |
| Molecular Formula | C28H44Cl2O4 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | bis(7-chloro-3,7-dimethyloctyl) benzene-1,4-dicarboxylate |
| SMILES | CC(CCCC(C)(C)Cl)CCOC(=O)c1ccc(C(=O)OCCC(C)CCCC(C)(C)Cl)cc1 |
| InChI | InChI=1S/C28H44Cl2O4/c1-21(9-7-17-27(3,4)29)15-19-33-25(31)23-11-13-24(14-12-23)26(32)34-20-16-22(2)10-8-18-28(5,6)30/h11-14,21-22H,7-10,15-20H2,1-6H3 |
| InChIKey | ONWBBLUXOSNWAV-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|