C39H63Cl3O6 — CID 71202816
tris(7-chloro-3,7-dimethyloctyl) benzene-1,3,5-tricarboxylate (PubChem CID 71202816) has the molecular formula C39H63Cl3O6 and a molecular weight of 734.29 g/mol. Its IUPAC name is tris(7-chloro-3,7-dimethyloctyl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(7-chloro-3,7-dimethyloctyl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 71202816 |
| Molecular Formula | C39H63Cl3O6 |
| Molecular Weight | 734.29 g/mol |
| Exact Mass | 732.37 |
| IUPAC Name | tris(7-chloro-3,7-dimethyloctyl) benzene-1,3,5-tricarboxylate |
| SMILES | CC(CCCC(C)(C)Cl)CCOC(=O)c1cc(C(=O)OCCC(C)CCCC(C)(C)Cl)cc(C(=O)OCCC(C)CCCC(C)(C)Cl)c1 |
| InChI | InChI=1S/C39H63Cl3O6/c1-28(13-10-19-37(4,5)40)16-22-46-34(43)31-25-32(35(44)47-23-17-29(2)14-11-20-38(6,7)41)27-33(26-31)36(45)48-24-18-30(3)15-12-21-39(8,9)42/h25-30H,10-24H2,1-9H3 |
| InChIKey | UZPAQWIQBGXZND-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.29 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|