C17H28O3S — CID 126624306
[4-[dimethyl(propan-2-yl)-λ4-sulfanyl]-3-methylbutyl] 4-hydroxybenzoate (PubChem CID 126624306) has the molecular formula C17H28O3S and a molecular weight of 312.47 g/mol. Its IUPAC name is [4-[dimethyl(propan-2-yl)-λ4-sulfanyl]-3-methylbutyl] 4-hydroxybenzoate.
| Compound Name | [4-[dimethyl(propan-2-yl)-λ4-sulfanyl]-3-methylbutyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 126624306 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [4-[dimethyl(propan-2-yl)-λ4-sulfanyl]-3-methylbutyl] 4-hydroxybenzoate |
| SMILES | CC(CCOC(=O)c1ccc(O)cc1)CS(C)(C)C(C)C |
| InChI | InChI=1S/C17H28O3S/c1-13(2)21(4,5)12-14(3)10-11-20-17(19)15-6-8-16(18)9-7-15/h6-9,13-14,18H,10-12H2,1-5H3 |
| InChIKey | DPXLRVYYNBXSGA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |