C22H16Cl2N2O3 — CID 156813887
3-pyridin-3-ylpropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 156813887) has the molecular formula C22H16Cl2N2O3 and a molecular weight of 427.29 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 156813887 |
| Molecular Formula | C22H16Cl2N2O3 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | O=C(OCCCc1cccnc1)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C22H16Cl2N2O3/c23-17-9-16(10-18(24)12-17)21-26-19-6-5-15(11-20(19)29-21)22(27)28-8-2-4-14-3-1-7-25-13-14/h1,3,5-7,9-13H,2,4,8H2 |
| InChIKey | SKUQVPNGABDVPU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|