C35H27Cl2NO3P+ — CID 156813921
3-[2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carbonyl]oxypropyl-triphenylphosphanium (PubChem CID 156813921) has the molecular formula C35H27Cl2NO3P+ and a molecular weight of 611.49 g/mol. Its IUPAC name is 3-[2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carbonyl]oxypropyl-triphenylphosphanium.
| Compound Name | 3-[2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carbonyl]oxypropyl-triphenylphosphanium |
|---|---|
| PubChem CID | 156813921 |
| Molecular Formula | C35H27Cl2NO3P+ |
| Molecular Weight | 611.49 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | 3-[2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carbonyl]oxypropyl-triphenylphosphanium |
| SMILES | O=C(OCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C35H27Cl2NO3P/c36-27-21-26(22-28(37)24-27)34-38-32-18-17-25(23-33(32)41-34)35(39)40-19-10-20-42(29-11-4-1-5-12-29,30-13-6-2-7-14-30)31-15-8-3-9-16-31/h1-9,11-18,21-24H,10,19-20H2/q+1 |
| InChIKey | KNSWDVBPZQMNFH-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.49 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|