C21H19Cl2NO4 — CID 156813964
3-(oxolan-2-yl)propyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 156813964) has the molecular formula C21H19Cl2NO4 and a molecular weight of 420.29 g/mol. Its IUPAC name is 3-(oxolan-2-yl)propyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
| Compound Name | 3-(oxolan-2-yl)propyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 156813964 |
| Molecular Formula | C21H19Cl2NO4 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 3-(oxolan-2-yl)propyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | O=C(OCCCC1CCCO1)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C21H19Cl2NO4/c22-15-9-14(10-16(23)12-15)20-24-18-6-5-13(11-19(18)28-20)21(25)27-8-2-4-17-3-1-7-26-17/h5-6,9-12,17H,1-4,7-8H2 |
| InChIKey | APLFPHCPOGZIBW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|