C22H17Cl2N2O3+ — CID 156813960
3-pyridin-1-ium-1-ylpropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 156813960) has the molecular formula C22H17Cl2N2O3+ and a molecular weight of 428.30 g/mol. Its IUPAC name is 3-pyridin-1-ium-1-ylpropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
| Compound Name | 3-pyridin-1-ium-1-ylpropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 156813960 |
| Molecular Formula | C22H17Cl2N2O3+ |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3-pyridin-1-ium-1-ylpropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | O=C(OCCC[n+]1ccccc1)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C22H17Cl2N2O3/c23-17-11-16(12-18(24)14-17)21-25-19-6-5-15(13-20(19)29-21)22(27)28-10-4-9-26-7-2-1-3-8-26/h1-3,5-8,11-14H,4,9-10H2/q+1 |
| InChIKey | RGOLBKPNNLFYMH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|