C19H18Cl2N2O3 — CID 156813877
3-(dimethylamino)propyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate (PubChem CID 156813877) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate.
| Compound Name | 3-(dimethylamino)propyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
|---|---|
| PubChem CID | 156813877 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3-(dimethylamino)propyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate |
| SMILES | CN(C)CCCOC(=O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c1-23(2)6-3-7-25-19(24)12-4-5-16-17(10-12)26-18(22-16)13-8-14(20)11-15(21)9-13/h4-5,8-11H,3,6-7H2,1-2H3 |
| InChIKey | CDMMFUUBKNCGHG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|