C17H15Cl3N2O3 — CID 156813816
3-aminopropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate;hydrochloride (PubChem CID 156813816) has the molecular formula C17H15Cl3N2O3 and a molecular weight of 401.68 g/mol. Its IUPAC name is 3-aminopropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate;hydrochloride.
| Compound Name | 3-aminopropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 156813816 |
| Molecular Formula | C17H15Cl3N2O3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 3-aminopropyl 2-(3,5-dichlorophenyl)-1,3-benzoxazole-6-carboxylate;hydrochloride |
| SMILES | Cl.NCCCOC(=O)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C17H14Cl2N2O3.ClH/c18-12-6-11(7-13(19)9-12)16-21-14-3-2-10(8-15(14)24-16)17(22)23-5-1-4-20;/h2-3,6-9H,1,4-5,20H2;1H |
| InChIKey | BILLAAABTZQRHA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|